C18H20F2N2O — CID 109036765
3-(3,4-difluoroanilino)-N-(2-propan-2-ylphenyl)propanamide (PubChem CID 109036765) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-(3,4-difluoroanilino)-N-(2-propan-2-ylphenyl)propanamide.
| Compound Name | 3-(3,4-difluoroanilino)-N-(2-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 109036765 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-(3,4-difluoroanilino)-N-(2-propan-2-ylphenyl)propanamide |
| SMILES | CC(C)c1ccccc1NC(=O)CCNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H20F2N2O/c1-12(2)14-5-3-4-6-17(14)22-18(23)9-10-21-13-7-8-15(19)16(20)11-13/h3-8,11-12,21H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | JNKIVHPWWBLCHO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |