C17H19FN2O3 — CID 109037732
N-(2,5-dimethoxyphenyl)-3-(4-fluoroanilino)propanamide (PubChem CID 109037732) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(4-fluoroanilino)propanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(4-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 109037732 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(4-fluoroanilino)propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)CCNc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FN2O3/c1-22-14-7-8-16(23-2)15(11-14)20-17(21)9-10-19-13-5-3-12(18)4-6-13/h3-8,11,19H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | IFEVMSUUGBQKCH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |