C18H36O4Si — CID 10904069
3-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,5-dimethyl-1,3-dioxan-2-yl]propanal (PubChem CID 10904069) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,5-dimethyl-1,3-dioxan-2-yl]propanal.
| Compound Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,5-dimethyl-1,3-dioxan-2-yl]propanal |
|---|---|
| PubChem CID | 10904069 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,5-dimethyl-1,3-dioxan-2-yl]propanal |
| SMILES | CC1(C)COC(CCC=O)(CCCO[Si](C)(C)C(C)(C)C)OC1 |
| InChI | InChI=1S/C18H36O4Si/c1-16(2,3)23(6,7)22-13-9-11-18(10-8-12-19)20-14-17(4,5)15-21-18/h12H,8-11,13-15H2,1-7H3 |
| InChIKey | DKIJKMXOQLJQOF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|