C16H14BrF3N2O — CID 109040694
N-(3-bromophenyl)-3-[2-(trifluoromethyl)anilino]propanamide (PubChem CID 109040694) has the molecular formula C16H14BrF3N2O and a molecular weight of 387.20 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-[2-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(3-bromophenyl)-3-[2-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 109040694 |
| Molecular Formula | C16H14BrF3N2O |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | N-(3-bromophenyl)-3-[2-(trifluoromethyl)anilino]propanamide |
| SMILES | O=C(CCNc1ccccc1C(F)(F)F)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrF3N2O/c17-11-4-3-5-12(10-11)22-15(23)8-9-21-14-7-2-1-6-13(14)16(18,19)20/h1-7,10,21H,8-9H2,(H,22,23) |
| InChIKey | FUGJNPNMCLWHTM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |