C19H23F2N3O — CID 109041734
3-[4-(diethylamino)anilino]-N-(2,4-difluorophenyl)propanamide (PubChem CID 109041734) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[4-(diethylamino)anilino]-N-(2,4-difluorophenyl)propanamide.
| Compound Name | 3-[4-(diethylamino)anilino]-N-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109041734 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-[4-(diethylamino)anilino]-N-(2,4-difluorophenyl)propanamide |
| SMILES | CCN(CC)c1ccc(NCCC(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H23F2N3O/c1-3-24(4-2)16-8-6-15(7-9-16)22-12-11-19(25)23-18-10-5-14(20)13-17(18)21/h5-10,13,22H,3-4,11-12H2,1-2H3,(H,23,25) |
| InChIKey | MBRPOJUGALSLBM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|