About methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate
methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate (PubChem CID 10904217) has the molecular formula C19H31NO3Si
and a molecular weight of 349.55 g/mol. Its IUPAC name is methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate |
| PubChem CID | 10904217 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate |
| SMILES | COC(=O)NC(/C=C/[C@H](C)O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H31NO3Si/c1-15(23-24(6,7)19(2,3)4)13-14-17(20-18(21)22-5)16-11-9-8-10-12-16/h8-15,17H,1-7H3,(H,20,21)/b14-13+/t15-,17?/m0/s1 |
| InChIKey | LUDNODRXIXACLX-WVXXVBDUSA-N |
| XLogP | 5.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate?
The IUPAC name of methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate (CID 10904217) is methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate.
What is the SMILES notation for methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate?
The canonical SMILES for methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate is COC(=O)NC(/C=C/[C@H](C)O[Si](C)(C)C(C)(C)C)c1ccccc1.
What is the InChIKey of methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate?
The InChIKey is LUDNODRXIXACLX-WVXXVBDUSA-N. The full InChI is InChI=1S/C19H31NO3Si/c1-15(23-24(6,7)19(2,3)4)13-14-17(20-18(21)22-5)16-11-9-8-10-12-16/h8-15,17H,1-7H3,(H,20,21)/b14-13+/t15-,17?/m0/s1.
What are the key properties of methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate?
methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate has a molecular weight of 349.55 g/mol, XLogP of 5.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-2-enyl]carbamate is sourced from PubChem (CID 10904217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).