About chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone
chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone (PubChem CID 10904262) has the molecular formula C11H13ClO4Pd
and a molecular weight of 351.09 g/mol. Its IUPAC name is chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone.
Molecular Properties
| Compound Name | chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone |
| PubChem CID | 10904262 |
| Molecular Formula | C11H13ClO4Pd |
| Molecular Weight | 351.09 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone |
| SMILES | COc1[c-]c(C(C)=O)cc(OC)c1OC.Cl[Pd+] |
| InChI | InChI=1S/C11H13O4.ClH.Pd/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3;;/h5H,1-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | FRYGSIZBDBWYPI-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone?
The IUPAC name of chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone (CID 10904262) is chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone.
What is the SMILES notation for chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone?
The canonical SMILES for chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone is COc1[c-]c(C(C)=O)cc(OC)c1OC.Cl[Pd+].
What is the InChIKey of chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone?
The InChIKey is FRYGSIZBDBWYPI-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13O4.ClH.Pd/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3;;/h5H,1-4H3;1H;/q-1;;+2/p-1.
What are the key properties of chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone?
chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone has a molecular weight of 351.09 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloropalladium(1+);1-(3,4,5-trimethoxybenzene-6-id-1-yl)ethanone is sourced from PubChem (CID 10904262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).