C20H17N7 — CID 10904370
4-phenyl-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10904370) has the molecular formula C20H17N7 and a molecular weight of 355.41 g/mol. Its IUPAC name is 4-phenyl-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-phenyl-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10904370 |
| Molecular Formula | C20H17N7 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-phenyl-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCc2ccccc2)c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C20H17N7/c21-20-24-18-16(13-22-26(18)12-11-14-7-3-1-4-8-14)19-23-17(25-27(19)20)15-9-5-2-6-10-15/h1-10,13H,11-12H2,(H2,21,24) |
| InChIKey | VVMOQQWICVMRIP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |