C19H22N2O2 — CID 109043733
1-N-butyl-4-N-methyl-4-N-phenylbenzene-1,4-dicarboxamide (PubChem CID 109043733) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-N-butyl-4-N-methyl-4-N-phenylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-butyl-4-N-methyl-4-N-phenylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043733 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-N-butyl-4-N-methyl-4-N-phenylbenzene-1,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1ccc(C(=O)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-4-14-20-18(22)15-10-12-16(13-11-15)19(23)21(2)17-8-6-5-7-9-17/h5-13H,3-4,14H2,1-2H3,(H,20,22) |
| InChIKey | WWLNBKGUGXEPFS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|