About S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate
S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate (PubChem CID 10904553) has the molecular formula C18H38O3SSi
and a molecular weight of 362.65 g/mol. Its IUPAC name is S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate.
Molecular Properties
| Compound Name | S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate |
| PubChem CID | 10904553 |
| Molecular Formula | C18H38O3SSi |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate |
| SMILES | CO[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C18H38O3SSi/c1-14(16(19)22-17(2,3)4)15(20-8)12-11-13-21-23(9,10)18(5,6)7/h14-15H,11-13H2,1-10H3/t14-,15-/m1/s1 |
| InChIKey | VXYRJENWZSPDNS-HUUCEWRRSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate?
The IUPAC name of S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate (CID 10904553) is S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate.
What is the SMILES notation for S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate?
The canonical SMILES for S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate is CO[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate?
The InChIKey is VXYRJENWZSPDNS-HUUCEWRRSA-N. The full InChI is InChI=1S/C18H38O3SSi/c1-14(16(19)22-17(2,3)4)15(20-8)12-11-13-21-23(9,10)18(5,6)7/h14-15H,11-13H2,1-10H3/t14-,15-/m1/s1.
What are the key properties of S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate?
S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate has a molecular weight of 362.65 g/mol, XLogP of 5.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl (2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methylhexanethioate is sourced from PubChem (CID 10904553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).