C20H32O4Si — CID 10904596
[(2R,3R,5R)-5-(5-ethyl-4-trimethylsilyloxolan-2-yl)-2-[(E)-pent-2-en-4-ynyl]oxolan-3-yl] acetate (PubChem CID 10904596) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(5-ethyl-4-trimethylsilyloxolan-2-yl)-2-[(E)-pent-2-en-4-ynyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-5-(5-ethyl-4-trimethylsilyloxolan-2-yl)-2-[(E)-pent-2-en-4-ynyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10904596 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(2R,3R,5R)-5-(5-ethyl-4-trimethylsilyloxolan-2-yl)-2-[(E)-pent-2-en-4-ynyl]oxolan-3-yl] acetate |
| SMILES | C#C/C=C/C[C@H]1O[C@@H](C2CC([Si](C)(C)C)C(CC)O2)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O4Si/c1-7-9-10-11-16-17(22-14(3)21)12-18(24-16)19-13-20(25(4,5)6)15(8-2)23-19/h1,9-10,15-20H,8,11-13H2,2-6H3/b10-9+/t15?,16-,17-,18-,19?,20?/m1/s1 |
| InChIKey | OJCSOWFKGVYITJ-RMJGDAIESA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|