C19H26O7 — CID 10904631
[(1S,2R,4S,5R)-4-ethoxycarbonyl-5-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 10904631) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-4-ethoxycarbonyl-5-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1S,2R,4S,5R)-4-ethoxycarbonyl-5-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 10904631 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(1S,2R,4S,5R)-4-ethoxycarbonyl-5-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](OC(=O)[C@@]23CC[C@@](C)(C(=O)O2)C3(C)C)[C@@H]2O[C@]12C |
| InChI | InChI=1S/C19H26O7/c1-6-23-13(20)10-9-11(12-18(10,5)25-12)24-15(22)19-8-7-17(4,14(21)26-19)16(19,2)3/h10-12H,6-9H2,1-5H3/t10-,11-,12+,17+,18-,19-/m1/s1 |
| InChIKey | PNCWEFNVKMMUKH-APMSNMIYSA-N |
| XLogP | 1.76 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|