C19H18N8O — CID 10904839
10-[3-(4-aminophenyl)propyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10904839) has the molecular formula C19H18N8O and a molecular weight of 374.41 g/mol. Its IUPAC name is 10-[3-(4-aminophenyl)propyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[3-(4-aminophenyl)propyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10904839 |
| Molecular Formula | C19H18N8O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 10-[3-(4-aminophenyl)propyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1ccc(CCCn2ncc3c2nc(N)n2nc(-c4ccco4)nc32)cc1 |
| InChI | InChI=1S/C19H18N8O/c20-13-7-5-12(6-8-13)3-1-9-26-17-14(11-22-26)18-23-16(15-4-2-10-28-15)25-27(18)19(21)24-17/h2,4-8,10-11H,1,3,9,20H2,(H2,21,24) |
| InChIKey | QXXUKKUVQMADQS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|