C24H21N3O2 — CID 109048503
4-N-(3-cyanophenyl)-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide (PubChem CID 109048503) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109048503 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-N-(3-cyanophenyl)-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(C(=O)NCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H21N3O2/c25-17-19-8-4-10-22(16-19)27-24(29)21-13-11-20(12-14-21)23(28)26-15-5-9-18-6-2-1-3-7-18/h1-4,6-8,10-14,16H,5,9,15H2,(H,26,28)(H,27,29) |
| InChIKey | OEFJDPBQCHPBBQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|