C22H29N3O2 — CID 109048527
4-N-tert-butyl-1-N-[4-(diethylamino)phenyl]benzene-1,4-dicarboxamide (PubChem CID 109048527) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-[4-(diethylamino)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-1-N-[4-(diethylamino)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109048527 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-N-tert-butyl-1-N-[4-(diethylamino)phenyl]benzene-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(C(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-6-25(7-2)19-14-12-18(13-15-19)23-20(26)16-8-10-17(11-9-16)21(27)24-22(3,4)5/h8-15H,6-7H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | AZXSACCYFISJFD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|