C25H25N3O2 — CID 109049443
1-N-(4-methylphenyl)-4-N-(4-pyrrolidin-1-ylphenyl)benzene-1,4-dicarboxamide (PubChem CID 109049443) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-N-(4-methylphenyl)-4-N-(4-pyrrolidin-1-ylphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-(4-methylphenyl)-4-N-(4-pyrrolidin-1-ylphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109049443 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-N-(4-methylphenyl)-4-N-(4-pyrrolidin-1-ylphenyl)benzene-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(N4CCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-18-4-10-21(11-5-18)26-24(29)19-6-8-20(9-7-19)25(30)27-22-12-14-23(15-13-22)28-16-2-3-17-28/h4-15H,2-3,16-17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | ACQMGMXIMKEUDT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|