About 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one
5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one (PubChem CID 10904975) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one.
Molecular Properties
| Compound Name | 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one |
| PubChem CID | 10904975 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one |
| SMILES | O=C(CCCCN1CCN(c2noc3ccccc23)CC1)c1ccccc1O |
| InChI | InChI=1S/C22H25N3O3/c26-19-9-3-1-7-17(19)20(27)10-5-6-12-24-13-15-25(16-14-24)22-18-8-2-4-11-21(18)28-23-22/h1-4,7-9,11,26H,5-6,10,12-16H2 |
| InChIKey | SRHNYUXLRPKDLG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one?
The IUPAC name of 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one (CID 10904975) is 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one.
What is the SMILES notation for 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one?
The canonical SMILES for 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one is O=C(CCCCN1CCN(c2noc3ccccc23)CC1)c1ccccc1O.
What is the InChIKey of 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one?
The InChIKey is SRHNYUXLRPKDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3/c26-19-9-3-1-7-17(19)20(27)10-5-6-12-24-13-15-25(16-14-24)22-18-8-2-4-11-21(18)28-23-22/h1-4,7-9,11,26H,5-6,10,12-16H2.
What are the key properties of 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one?
5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one has a molecular weight of 379.46 g/mol, XLogP of 3.71, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)pentan-1-one is sourced from PubChem (CID 10904975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).