C22H14N4O2 — CID 109050250
4-N-(2-cyanophenyl)-1-N-(4-cyanophenyl)benzene-1,4-dicarboxamide (PubChem CID 109050250) has the molecular formula C22H14N4O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-N-(2-cyanophenyl)-1-N-(4-cyanophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-cyanophenyl)-1-N-(4-cyanophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109050250 |
| Molecular Formula | C22H14N4O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-N-(2-cyanophenyl)-1-N-(4-cyanophenyl)benzene-1,4-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(C(=O)Nc3ccccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C22H14N4O2/c23-13-15-5-11-19(12-6-15)25-21(27)16-7-9-17(10-8-16)22(28)26-20-4-2-1-3-18(20)14-24/h1-12H,(H,25,27)(H,26,28) |
| InChIKey | KRZUBXPMNDMWIF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |