C22H29NO3Si — CID 10905089
(2R,3R)-N-methoxy-N,2,4-trimethyl-3-[methyl(diphenyl)silyl]oxypent-4-enamide (PubChem CID 10905089) has the molecular formula C22H29NO3Si and a molecular weight of 383.56 g/mol. Its IUPAC name is (2R,3R)-N-methoxy-N,2,4-trimethyl-3-[methyl(diphenyl)silyl]oxypent-4-enamide.
| Compound Name | (2R,3R)-N-methoxy-N,2,4-trimethyl-3-[methyl(diphenyl)silyl]oxypent-4-enamide |
|---|---|
| PubChem CID | 10905089 |
| Molecular Formula | C22H29NO3Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R,3R)-N-methoxy-N,2,4-trimethyl-3-[methyl(diphenyl)silyl]oxypent-4-enamide |
| SMILES | C=C(C)[C@H](O[Si](C)(c1ccccc1)c1ccccc1)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C22H29NO3Si/c1-17(2)21(18(3)22(24)23(4)25-5)26-27(6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21H,1H2,2-6H3/t18-,21+/m1/s1 |
| InChIKey | RLJLVKOAUAJSSB-NQIIRXRSSA-N |
| XLogP | 2.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|