C17H24N2O2 — CID 109051430
3-N-butan-2-yl-1-N-cyclopentylbenzene-1,3-dicarboxamide (PubChem CID 109051430) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-N-butan-2-yl-1-N-cyclopentylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-butan-2-yl-1-N-cyclopentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051430 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-N-butan-2-yl-1-N-cyclopentylbenzene-1,3-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-12(2)18-16(20)13-7-6-8-14(11-13)17(21)19-15-9-4-5-10-15/h6-8,11-12,15H,3-5,9-10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | MNSFPADLWUKPBK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |