C13H17N5O5S2 — CID 10905170
2-[2-[[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethylamino]acetic acid (PubChem CID 10905170) has the molecular formula C13H17N5O5S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[2-[[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 10905170 |
| Molecular Formula | C13H17N5O5S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[2-[[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethylamino]acetic acid |
| SMILES | NS(=O)(=O)c1nc2ccc(NC(=O)CNCCNCC(=O)O)cc2s1 |
| InChI | InChI=1S/C13H17N5O5S2/c14-25(22,23)13-18-9-2-1-8(5-10(9)24-13)17-11(19)6-15-3-4-16-7-12(20)21/h1-2,5,15-16H,3-4,6-7H2,(H,17,19)(H,20,21)(H2,14,22,23) |
| InChIKey | XWLKZMDKSFVNTQ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|