About [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate
[fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate (PubChem CID 10905225) has the molecular formula C21H23FO4S
and a molecular weight of 390.48 g/mol. Its IUPAC name is [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate.
Molecular Properties
| Compound Name | [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate |
| PubChem CID | 10905225 |
| Molecular Formula | C21H23FO4S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate |
| SMILES | CC(=O)OC(F)[C@H]1S[C@@H](COCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H23FO4S/c1-15(23)26-21(22)20-19(25-13-17-10-6-3-7-11-17)18(27-20)14-24-12-16-8-4-2-5-9-16/h2-11,18-21H,12-14H2,1H3/t18-,19-,20-,21?/m0/s1 |
| InChIKey | IRDOREFMAPDHLQ-AVJWEPTDSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate?
The IUPAC name of [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate (CID 10905225) is [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate.
What is the SMILES notation for [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate?
The canonical SMILES for [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate is CC(=O)OC(F)[C@H]1S[C@@H](COCc2ccccc2)[C@@H]1OCc1ccccc1.
What is the InChIKey of [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate?
The InChIKey is IRDOREFMAPDHLQ-AVJWEPTDSA-N. The full InChI is InChI=1S/C21H23FO4S/c1-15(23)26-21(22)20-19(25-13-17-10-6-3-7-11-17)18(27-20)14-24-12-16-8-4-2-5-9-16/h2-11,18-21H,12-14H2,1H3/t18-,19-,20-,21?/m0/s1.
What are the key properties of [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate?
[fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate has a molecular weight of 390.48 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [fluoro-[(2S,3S,4S)-3-phenylmethoxy-4-(phenylmethoxymethyl)thietan-2-yl]methyl] acetate is sourced from PubChem (CID 10905225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).