C20H23N3O4 — CID 109053241
methyl 3-[[3-[2-(dimethylamino)ethylcarbamoyl]benzoyl]amino]benzoate (PubChem CID 109053241) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 3-[[3-[2-(dimethylamino)ethylcarbamoyl]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[2-(dimethylamino)ethylcarbamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 109053241 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl 3-[[3-[2-(dimethylamino)ethylcarbamoyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(C(=O)NCCN(C)C)c2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-23(2)11-10-21-18(24)14-6-4-7-15(12-14)19(25)22-17-9-5-8-16(13-17)20(26)27-3/h4-9,12-13H,10-11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | DDJGJCKMWJPWMZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |