C22H17F3N2O2 — CID 109054164
1-N-benzyl-3-N-[2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 109054164) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is 1-N-benzyl-3-N-[2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-[2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109054164 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-N-benzyl-3-N-[2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(C(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N2O2/c23-22(24,25)18-11-4-5-12-19(18)27-21(29)17-10-6-9-16(13-17)20(28)26-14-15-7-2-1-3-8-15/h1-13H,14H2,(H,26,28)(H,27,29) |
| InChIKey | SUGSGIOSNLBLJH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |