C22H19ClN2O2 — CID 109054323
3-N-(2-chlorophenyl)-1-N-[(3-methylphenyl)methyl]benzene-1,3-dicarboxamide (PubChem CID 109054323) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 3-N-(2-chlorophenyl)-1-N-[(3-methylphenyl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2-chlorophenyl)-1-N-[(3-methylphenyl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109054323 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-N-(2-chlorophenyl)-1-N-[(3-methylphenyl)methyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1cccc(CNC(=O)c2cccc(C(=O)Nc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C22H19ClN2O2/c1-15-6-4-7-16(12-15)14-24-21(26)17-8-5-9-18(13-17)22(27)25-20-11-3-2-10-19(20)23/h2-13H,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | ACHPLPJWKYGIJM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |