C23H31NO5 — CID 10905482
methyl 2-[(1R,5R,8aR)-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate (PubChem CID 10905482) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is methyl 2-[(1R,5R,8aR)-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate.
| Compound Name | methyl 2-[(1R,5R,8aR)-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 10905482 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | methyl 2-[(1R,5R,8aR)-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate |
| SMILES | CCCCC[C@H](OCc1ccccc1)[C@@H]1OC(=O)N2[C@@H](CC(=O)OC)CC=C[C@H]12 |
| InChI | InChI=1S/C23H31NO5/c1-3-4-6-14-20(28-16-17-10-7-5-8-11-17)22-19-13-9-12-18(15-21(25)27-2)24(19)23(26)29-22/h5,7-11,13,18-20,22H,3-4,6,12,14-16H2,1-2H3/t18-,19-,20+,22-/m1/s1 |
| InChIKey | LIDDPKKEUMGBDV-XWSHUIEDSA-N |
| XLogP | 4.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|