C23H23N3O2 — CID 109055074
1-N-(3-phenylpropyl)-3-N-(pyridin-3-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 109055074) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-N-(3-phenylpropyl)-3-N-(pyridin-3-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(3-phenylpropyl)-3-N-(pyridin-3-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055074 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-N-(3-phenylpropyl)-3-N-(pyridin-3-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cccc(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C23H23N3O2/c27-22(25-14-6-9-18-7-2-1-3-8-18)20-11-4-12-21(15-20)23(28)26-17-19-10-5-13-24-16-19/h1-5,7-8,10-13,15-16H,6,9,14,17H2,(H,25,27)(H,26,28) |
| InChIKey | UXGWJSDSSQWYNF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|