C23H18F2N2O2 — CID 109055372
N-(2,6-difluorophenyl)-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)benzamide (PubChem CID 109055372) has the molecular formula C23H18F2N2O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 109055372 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)benzamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cccc(C(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C23H18F2N2O2/c24-19-9-4-10-20(25)21(19)26-22(28)16-7-3-8-17(13-16)23(29)27-12-11-15-5-1-2-6-18(15)14-27/h1-10,13H,11-12,14H2,(H,26,28) |
| InChIKey | FSJBRGWBILRWQN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |