About methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate
methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate (PubChem CID 10905555) has the molecular formula C19H40O5Si2
and a molecular weight of 404.70 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate.
Molecular Properties
| Compound Name | methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate |
| PubChem CID | 10905555 |
| Molecular Formula | C19H40O5Si2 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O5Si2/c1-18(2,3)25(8,9)23-15(13-12-14-20)16(17(21)22-7)24-26(10,11)19(4,5)6/h14-16H,12-13H2,1-11H3/t15-,16-/m0/s1 |
| InChIKey | YXQKGEUCBMNKRK-HOTGVXAUSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate?
The IUPAC name of methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate (CID 10905555) is methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate.
What is the SMILES notation for methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate?
The canonical SMILES for methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate is COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate?
The InChIKey is YXQKGEUCBMNKRK-HOTGVXAUSA-N. The full InChI is InChI=1S/C19H40O5Si2/c1-18(2,3)25(8,9)23-15(13-12-14-20)16(17(21)22-7)24-26(10,11)19(4,5)6/h14-16H,12-13H2,1-11H3/t15-,16-/m0/s1.
What are the key properties of methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate?
methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate has a molecular weight of 404.70 g/mol, XLogP of 4.92, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate is sourced from PubChem (CID 10905555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).