C20H21N3O2 — CID 109056342
3-N-(2-cyanophenyl)-1-N-pentylbenzene-1,3-dicarboxamide (PubChem CID 109056342) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-N-(2-cyanophenyl)-1-N-pentylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2-cyanophenyl)-1-N-pentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109056342 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-N-(2-cyanophenyl)-1-N-pentylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cccc(C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-2-3-6-12-22-19(24)15-9-7-10-16(13-15)20(25)23-18-11-5-4-8-17(18)14-21/h4-5,7-11,13H,2-3,6,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZVYMIISAWCQRNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|