C24H21ClO2S — CID 10905659
methyl 6-(3-chlorophenyl)-4-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-3-carboxylate (PubChem CID 10905659) has the molecular formula C24H21ClO2S and a molecular weight of 408.95 g/mol. Its IUPAC name is methyl 6-(3-chlorophenyl)-4-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-3-carboxylate.
| Compound Name | methyl 6-(3-chlorophenyl)-4-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 10905659 |
| Molecular Formula | C24H21ClO2S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | methyl 6-(3-chlorophenyl)-4-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-3-carboxylate |
| SMILES | COC(=O)c1c(SC)cc(-c2cccc(Cl)c2)c2c1-c1ccccc1CCC2 |
| InChI | InChI=1S/C24H21ClO2S/c1-27-24(26)23-21(28-2)14-20(16-9-5-10-17(25)13-16)19-12-6-8-15-7-3-4-11-18(15)22(19)23/h3-5,7,9-11,13-14H,6,8,12H2,1-2H3 |
| InChIKey | ZXONTDNDMVMXNM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |