C21H20ClN3O4 — CID 10905740
4-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-1H-quinoxaline-2,3-dione (PubChem CID 10905740) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10905740 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]-1H-quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccccc2n(C2CCN(Cc3cc4c(cc3Cl)OCO4)CC2)c1=O |
| InChI | InChI=1S/C21H20ClN3O4/c22-15-10-19-18(28-12-29-19)9-13(15)11-24-7-5-14(6-8-24)25-17-4-2-1-3-16(17)23-20(26)21(25)27/h1-4,9-10,14H,5-8,11-12H2,(H,23,26) |
| InChIKey | VPZVRDLFBIYDOY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|