C20H31BrO4 — CID 10905777
methyl (1R,3aS,7aR)-4-[(E)-4-bromobut-2-enyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,3a,6,7-hexahydroindene-4-carboxylate (PubChem CID 10905777) has the molecular formula C20H31BrO4 and a molecular weight of 415.37 g/mol. Its IUPAC name is methyl (1R,3aS,7aR)-4-[(E)-4-bromobut-2-enyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,3a,6,7-hexahydroindene-4-carboxylate.
| Compound Name | methyl (1R,3aS,7aR)-4-[(E)-4-bromobut-2-enyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,3a,6,7-hexahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 10905777 |
| Molecular Formula | C20H31BrO4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl (1R,3aS,7aR)-4-[(E)-4-bromobut-2-enyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,3a,6,7-hexahydroindene-4-carboxylate |
| SMILES | COC(=O)C1(C/C=C/CBr)C(=O)CC[C@]2(C)[C@@H]1CC[C@H]2OC(C)(C)C |
| InChI | InChI=1S/C20H31BrO4/c1-18(2,3)25-16-9-8-14-19(16,4)12-10-15(22)20(14,17(23)24-5)11-6-7-13-21/h6-7,14,16H,8-13H2,1-5H3/b7-6+/t14-,16+,19+,20?/m0/s1 |
| InChIKey | BFPNYAZTZCWLTE-YDGLJIRXSA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|