C18H19FN2O3S — CID 109058444
4-[2-(4-fluorophenyl)ethylsulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 109058444) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethylsulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[2-(4-fluorophenyl)ethylsulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 109058444 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethylsulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(S(=O)(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O3S/c1-2-12-20-18(22)15-5-9-17(10-6-15)25(23,24)21-13-11-14-3-7-16(19)8-4-14/h2-10,21H,1,11-13H2,(H,20,22) |
| InChIKey | CYIJBXLWAXXCDY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|