C20H24N2O3S — CID 109058553
N-(2,6-diethylphenyl)-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 109058553) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-(2,6-diethylphenyl)-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 109058553 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-(2,6-diethylphenyl)-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)Nc2c(CC)cccc2CC)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-14-21-26(24,25)18-12-10-17(11-13-18)20(23)22-19-15(5-2)8-7-9-16(19)6-3/h4,7-13,21H,1,5-6,14H2,2-3H3,(H,22,23) |
| InChIKey | ZCRILWKWZPHOLA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|