C23H38O5Si — CID 10905958
(2E,4E,6E,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-12-(oxan-2-yloxy)dodeca-2,4,6,10-tetraenoic acid (PubChem CID 10905958) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (2E,4E,6E,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-12-(oxan-2-yloxy)dodeca-2,4,6,10-tetraenoic acid.
| Compound Name | (2E,4E,6E,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-12-(oxan-2-yloxy)dodeca-2,4,6,10-tetraenoic acid |
|---|---|
| PubChem CID | 10905958 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2E,4E,6E,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-12-(oxan-2-yloxy)dodeca-2,4,6,10-tetraenoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/COC1CCCCO1)C/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C23H38O5Si/c1-23(2,3)29(4,5)28-20(14-9-7-6-8-10-16-21(24)25)15-13-19-27-22-17-11-12-18-26-22/h6-10,13,15-16,20,22H,11-12,14,17-19H2,1-5H3,(H,24,25)/b8-6+,9-7+,15-13+,16-10+/t20-,22?/m0/s1 |
| InChIKey | NDABRQOYKLDWAR-WDNIKSLSSA-N |
| XLogP | 5.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|