C25H29NO5 — CID 10905969
dimethyl 2-[(1S,3R,4aS,9S,9aR)-1-methoxy-9-phenyl-1,2,3,4,4a,9,9a,10-octahydroacridin-3-yl]propanedioate (PubChem CID 10905969) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is dimethyl 2-[(1S,3R,4aS,9S,9aR)-1-methoxy-9-phenyl-1,2,3,4,4a,9,9a,10-octahydroacridin-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,3R,4aS,9S,9aR)-1-methoxy-9-phenyl-1,2,3,4,4a,9,9a,10-octahydroacridin-3-yl]propanedioate |
|---|---|
| PubChem CID | 10905969 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | dimethyl 2-[(1S,3R,4aS,9S,9aR)-1-methoxy-9-phenyl-1,2,3,4,4a,9,9a,10-octahydroacridin-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C[C@@H]2Nc3ccccc3[C@H](c3ccccc3)[C@H]2[C@@H](OC)C1 |
| InChI | InChI=1S/C25H29NO5/c1-29-20-14-16(22(24(27)30-2)25(28)31-3)13-19-23(20)21(15-9-5-4-6-10-15)17-11-7-8-12-18(17)26-19/h4-12,16,19-23,26H,13-14H2,1-3H3/t16-,19+,20+,21+,23-/m1/s1 |
| InChIKey | UFGKGGPKGGXANP-WCJMXFJFSA-N |
| XLogP | 3.62 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|