C16H27N3O3S — CID 109060155
4-[2-(dimethylamino)ethylsulfamoyl]-N-pentylbenzamide (PubChem CID 109060155) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylsulfamoyl]-N-pentylbenzamide.
| Compound Name | 4-[2-(dimethylamino)ethylsulfamoyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 109060155 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-[2-(dimethylamino)ethylsulfamoyl]-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(S(=O)(=O)NCCN(C)C)cc1 |
| InChI | InChI=1S/C16H27N3O3S/c1-4-5-6-11-17-16(20)14-7-9-15(10-8-14)23(21,22)18-12-13-19(2)3/h7-10,18H,4-6,11-13H2,1-3H3,(H,17,20) |
| InChIKey | QDHKBUUKRWCHIQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|