C14H11Cl2NO4S — CID 1090608
N-(2,3-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 1090608) has the molecular formula C14H11Cl2NO4S and a molecular weight of 360.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 1090608 |
| Molecular Formula | C14H11Cl2NO4S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H11Cl2NO4S/c15-10-2-1-3-11(14(10)16)17-22(18,19)9-4-5-12-13(8-9)21-7-6-20-12/h1-5,8,17H,6-7H2 |
| InChIKey | CNQKKHWNTODQGE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |