C26H39NO4 — CID 10906109
tert-butyl (2R,6S)-2-[(E)-2-[(1S,3aS,8aR,9R,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-yl]ethenyl]-6-methylpiperidine-1-carboxylate (PubChem CID 10906109) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-[(E)-2-[(1S,3aS,8aR,9R,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-yl]ethenyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2-[(E)-2-[(1S,3aS,8aR,9R,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-yl]ethenyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10906109 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | tert-butyl (2R,6S)-2-[(E)-2-[(1S,3aS,8aR,9R,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-yl]ethenyl]-6-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1OC(=O)[C@H]2C=C3CCCC[C@@H]3[C@@H](/C=C/[C@H]3CCC[C@H](C)N3C(=O)OC(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C26H39NO4/c1-16-9-8-11-19(27(16)25(29)31-26(3,4)5)13-14-21-20-12-7-6-10-18(20)15-22-23(21)17(2)30-24(22)28/h13-17,19-23H,6-12H2,1-5H3/b14-13+/t16-,17-,19+,20-,21+,22-,23+/m0/s1 |
| InChIKey | APDGYHLVRMVOOR-CFDQNZEUSA-N |
| XLogP | 5.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|