C21H28N2O3S — CID 109061565
4-[(4-ethylphenyl)sulfamoyl]-N,N-dipropylbenzamide (PubChem CID 109061565) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)sulfamoyl]-N,N-dipropylbenzamide.
| Compound Name | 4-[(4-ethylphenyl)sulfamoyl]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 109061565 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-[(4-ethylphenyl)sulfamoyl]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(S(=O)(=O)Nc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-4-15-23(16-5-2)21(24)18-9-13-20(14-10-18)27(25,26)22-19-11-7-17(6-3)8-12-19/h7-14,22H,4-6,15-16H2,1-3H3 |
| InChIKey | FKEKBYQEZRGMOD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |