C22H22N2O3S — CID 109061718
4-[(2,4-dimethylphenyl)sulfamoyl]-N-methyl-N-phenylbenzamide (PubChem CID 109061718) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)sulfamoyl]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[(2,4-dimethylphenyl)sulfamoyl]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 109061718 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)sulfamoyl]-N-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N(C)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-16-9-14-21(17(2)15-16)23-28(26,27)20-12-10-18(11-13-20)22(25)24(3)19-7-5-4-6-8-19/h4-15,23H,1-3H3 |
| InChIKey | SKBBKMHDKGOPBH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |