C26H48O3Si — CID 10906247
(1S,2R,5R)-2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dienyl]-5-(2-hydroxypropan-2-yl)-2-methylcyclopentane-1-carbaldehyde (PubChem CID 10906247) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is (1S,2R,5R)-2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dienyl]-5-(2-hydroxypropan-2-yl)-2-methylcyclopentane-1-carbaldehyde.
| Compound Name | (1S,2R,5R)-2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dienyl]-5-(2-hydroxypropan-2-yl)-2-methylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 10906247 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (1S,2R,5R)-2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dienyl]-5-(2-hydroxypropan-2-yl)-2-methylcyclopentane-1-carbaldehyde |
| SMILES | C/C(=C\C[C@@]1(C)CC[C@@H](C(C)(C)O)[C@@H]1C=O)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-20(12-11-13-21(2)19-29-30(9,10)24(3,4)5)14-16-26(8)17-15-22(23(26)18-27)25(6,7)28/h13-14,18,22-23,28H,11-12,15-17,19H2,1-10H3/b20-14+,21-13+/t22-,23+,26+/m1/s1 |
| InChIKey | VFKQBLITKGLZNN-CSKIFRBJSA-N |
| XLogP | 7.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|