C15H24N2O3S — CID 109062541
3-(butan-2-ylsulfamoyl)-N-butylbenzamide (PubChem CID 109062541) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-(butan-2-ylsulfamoyl)-N-butylbenzamide.
| Compound Name | 3-(butan-2-ylsulfamoyl)-N-butylbenzamide |
|---|---|
| PubChem CID | 109062541 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(butan-2-ylsulfamoyl)-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1cccc(S(=O)(=O)NC(C)CC)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-4-6-10-16-15(18)13-8-7-9-14(11-13)21(19,20)17-12(3)5-2/h7-9,11-12,17H,4-6,10H2,1-3H3,(H,16,18) |
| InChIKey | RKIYALCXNHQYDE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|