C21H38O8Si — CID 10906415
ethyl (2S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,4S,5R)-5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 10906415) has the molecular formula C21H38O8Si and a molecular weight of 446.61 g/mol. Its IUPAC name is ethyl (2S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,4S,5R)-5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | ethyl (2S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,4S,5R)-5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 10906415 |
| Molecular Formula | C21H38O8Si |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | ethyl (2S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,4S,5R)-5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(O[Si](C)(C)C(C)(C)C)=C[C@H]([C@@H]2O[C@H](C)OC[C@H]2OCOC)O1 |
| InChI | InChI=1S/C21H38O8Si/c1-9-24-20(22)17-11-15(29-30(7,8)21(3,4)5)10-16(28-17)19-18(26-13-23-6)12-25-14(2)27-19/h10,14,16-19H,9,11-13H2,1-8H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | FTUDGAVGYDNMJE-FTWQHDNSSA-N |
| XLogP | 3.36 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|