C25H28F3NO3 — CID 10906425
(2E,4E)-5-[3-[3,5-di(propan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 10906425) has the molecular formula C25H28F3NO3 and a molecular weight of 447.50 g/mol. Its IUPAC name is (2E,4E)-5-[3-[3,5-di(propan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[3-[3,5-di(propan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10906425 |
| Molecular Formula | C25H28F3NO3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2E,4E)-5-[3-[3,5-di(propan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/c1ccncc1-c1cc(C(C)C)cc(C(C)C)c1OCC(F)(F)F)=C\C(=O)O |
| InChI | InChI=1S/C25H28F3NO3/c1-15(2)19-11-20(16(3)4)24(32-14-25(26,27)28)21(12-19)22-13-29-9-8-18(22)7-6-17(5)10-23(30)31/h6-13,15-16H,14H2,1-5H3,(H,30,31)/b7-6+,17-10+ |
| InChIKey | IJKIEQVMZRPXJB-HKHMFKSASA-N |
| XLogP | 6.98 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|