C19H28N2O5S — CID 109065051
3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-pentylbenzamide (PubChem CID 109065051) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-pentylbenzamide.
| Compound Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-pentylbenzamide |
|---|---|
| PubChem CID | 109065051 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cccc(S(=O)(=O)N2CCC3(CC2)OCCO3)c1 |
| InChI | InChI=1S/C19H28N2O5S/c1-2-3-4-10-20-18(22)16-6-5-7-17(15-16)27(23,24)21-11-8-19(9-12-21)25-13-14-26-19/h5-7,15H,2-4,8-14H2,1H3,(H,20,22) |
| InChIKey | XFPSCSBMUYWPSZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|