C26H36O5Si — CID 10906583
2-[(3aS,5S,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethanol (PubChem CID 10906583) has the molecular formula C26H36O5Si and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-[(3aS,5S,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethanol.
| Compound Name | 2-[(3aS,5S,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethanol |
|---|---|
| PubChem CID | 10906583 |
| Molecular Formula | C26H36O5Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-[(3aS,5S,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethanol |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](CCO)[C@@H]2O1 |
| InChI | InChI=1S/C26H36O5Si/c1-25(2,3)32(19-12-8-6-9-13-19,20-14-10-7-11-15-20)28-18-22-21(16-17-27)23-24(29-22)31-26(4,5)30-23/h6-15,21-24,27H,16-18H2,1-5H3/t21-,22+,23-,24-/m0/s1 |
| InChIKey | MDPWJKNJKVIMHL-KIHHCIJBSA-N |
| XLogP | 3.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|