C29H36O5 — CID 10906719
methyl (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-3-methoxy-1,4-bis(phenylmethoxy)cyclohexane-1-carboxylate (PubChem CID 10906719) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-3-methoxy-1,4-bis(phenylmethoxy)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-3-methoxy-1,4-bis(phenylmethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10906719 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | methyl (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-3-methoxy-1,4-bis(phenylmethoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC/C=C(\C)[C@H]1[C@H](OC)[C@H](OCc2ccccc2)CC[C@]1(OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C29H36O5/c1-5-6-13-22(2)26-27(31-3)25(33-20-23-14-9-7-10-15-23)18-19-29(26,28(30)32-4)34-21-24-16-11-8-12-17-24/h5,7-17,25-27H,1,6,18-21H2,2-4H3/b22-13+/t25-,26+,27-,29-/m1/s1 |
| InChIKey | AUXULRIUGFEIOQ-ZNRBCLOJSA-N |
| XLogP | 5.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|