C16H22N4O3 — CID 109067644
1-N-butan-2-yl-3-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067644) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-N-butan-2-yl-3-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-butan-2-yl-3-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067644 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-N-butan-2-yl-3-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1nc(C(=O)NCCOC)n2ccccc12 |
| InChI | InChI=1S/C16H22N4O3/c1-4-11(2)18-15(21)13-12-7-5-6-9-20(12)14(19-13)16(22)17-8-10-23-3/h5-7,9,11H,4,8,10H2,1-3H3,(H,17,22)(H,18,21) |
| InChIKey | OFKYZUMDCPNTMC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|